Products 1185300-55-3

CAS 1185300-55-3 is the registry number for [1-(1H-Imidazol-1-ylmethyl)-2,2-dimethylpropyl]amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 100g, 5g, 1g.

Structural formula: {0} (CAS {1})

1-imidazol-1-yl-3,3-dimethylbutan-2-amine;dihydrochloride (CAS 1185300-55-3) is a chemical compound with the molecular formula C9H19Cl2N3 and a molecular weight of 240.17 g/mol. IUPAC name: 1-imidazol-1-yl-3,3-dimethylbutan-2-amine;dihydrochloride. InChIKey: IBNJOMVWUURIJE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H19Cl2N3
Molecular weight240.17 g/mol
IUPAC name1-imidazol-1-yl-3,3-dimethylbutan-2-amine;dihydrochloride
InChIKeyIBNJOMVWUURIJE-UHFFFAOYSA-N
SMILESCC(C)(C)C(CN1C=CN=C1)N.Cl.Cl

Computed by PubChem (NCBI)