CAS 1255717-74-8 is the registry number for [1-(1-Ethyl-3,5-dimethyl-1h-pyrazol-4-yl)ethyl]amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.
1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethanamine;dihydrochloride (CAS 1255717-74-8) is a chemical compound with the molecular formula C9H19Cl2N3 and a molecular weight of 240.17 g/mol. IUPAC name: 1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethanamine;dihydrochloride. InChIKey: MLDZCRGQWXOLME-UHFFFAOYSA-N.
| Molecular formula | C9H19Cl2N3 |
|---|---|
| Molecular weight | 240.17 g/mol |
| IUPAC name | 1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethanamine;dihydrochloride |
| InChIKey | MLDZCRGQWXOLME-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C(=N1)C)C(C)N)C.Cl.Cl |
Computed by PubChem (NCBI)