CAS 1231961-65-1 is the registry number for ((5-tert-Butyl-1H-pyrazol-3-yl)methyl)methylaminedihydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g.
1-(3-tert-butyl-1H-pyrazol-5-yl)-N-methylmethanamine;dihydrochloride (CAS 1231961-65-1) is a chemical compound with the molecular formula C9H19Cl2N3 and a molecular weight of 240.17 g/mol. IUPAC name: 1-(3-tert-butyl-1H-pyrazol-5-yl)-N-methylmethanamine;dihydrochloride. InChIKey: YKRXMCUUQBPFEU-UHFFFAOYSA-N.
| Molecular formula | C9H19Cl2N3 |
|---|---|
| Molecular weight | 240.17 g/mol |
| IUPAC name | 1-(3-tert-butyl-1H-pyrazol-5-yl)-N-methylmethanamine;dihydrochloride |
| InChIKey | YKRXMCUUQBPFEU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NNC(=C1)CNC.Cl.Cl |
Computed by PubChem (NCBI)