CAS 1185302-86-6 is the registry number for 2-(3-(Pyridin-3-yl)-1,2,4-oxadiazol-5-yl)ethanamine 2,2,2-trifluoroacetate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethanamine;2,2,2-trifluoroacetic acid (CAS 1185302-86-6) is a chemical compound with the molecular formula C11H11F3N4O3 and a molecular weight of 304.23 g/mol. IUPAC name: 2-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethanamine;2,2,2-trifluoroacetic acid. InChIKey: MTBZMBJODDSYIK-UHFFFAOYSA-N.
| Molecular formula | C11H11F3N4O3 |
|---|---|
| Molecular weight | 304.23 g/mol |
| IUPAC name | 2-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethanamine;2,2,2-trifluoroacetic acid |
| InChIKey | MTBZMBJODDSYIK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NOC(=N2)CCN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)