CAS 1262774-59-3 is the registry number for (1-[3-(2-Pyridinyl)-1,2,4-oxadiazol-5-yl]ethyl)amine trifluoroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
1-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;2,2,2-trifluoroacetic acid (CAS 1262774-59-3) is a chemical compound with the molecular formula C11H11F3N4O3 and a molecular weight of 304.23 g/mol. IUPAC name: 1-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;2,2,2-trifluoroacetic acid. InChIKey: JTVCXEWWZBWCLC-UHFFFAOYSA-N.
| Molecular formula | C11H11F3N4O3 |
|---|---|
| Molecular weight | 304.23 g/mol |
| IUPAC name | 1-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;2,2,2-trifluoroacetic acid |
| InChIKey | JTVCXEWWZBWCLC-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=NO1)C2=CC=CC=N2)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)