CAS 1262772-93-9 is the registry number for {1-(3-(3-pyridinyl)-1,2,4-oxadiazol-5-yl)ethyl}amine trifluoroacetate, 97%. Offered by: AmBeed. Available pack sizes: 5g.
1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethanamine;2,2,2-trifluoroacetic acid (CAS 1262772-93-9) is a chemical compound with the molecular formula C11H11F3N4O3 and a molecular weight of 304.23 g/mol. IUPAC name: 1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethanamine;2,2,2-trifluoroacetic acid. InChIKey: KVTYFYILFBIUOX-UHFFFAOYSA-N.
| Molecular formula | C11H11F3N4O3 |
|---|---|
| Molecular weight | 304.23 g/mol |
| IUPAC name | 1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethanamine;2,2,2-trifluoroacetic acid |
| InChIKey | KVTYFYILFBIUOX-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=NO1)C2=CN=CC=C2)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)