CAS 1185307-04-3 is the registry number for 1–Chloro–4–(iso–propoxy–d7)–phthalazine. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
1-chloro-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)phthalazine (CAS 1185307-04-3) is a chemical compound with the molecular formula C11H11ClN2O and a molecular weight of 229.71 g/mol. IUPAC name: 1-chloro-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)phthalazine. InChIKey: UPMIMNOYHNXVDP-QXMYYZBZSA-N.
| Molecular formula | C11H11ClN2O |
|---|---|
| Molecular weight | 229.71 g/mol |
| IUPAC name | 1-chloro-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)phthalazine |
| InChIKey | UPMIMNOYHNXVDP-QXMYYZBZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])OC1=NN=C(C2=CC=CC=C21)Cl |
Computed by PubChem (NCBI)