CAS 118546-30-8 is the registry number for Indole-3-butyryl-L-alanine. Offered by: TRC. Available pack sizes: 100mg.
(2S)-2-[4-(1H-indol-3-yl)butanoylamino]propanoic acid (CAS 118546-30-8) is a chemical compound with the molecular formula C15H18N2O3 and a molecular weight of 274.31 g/mol. IUPAC name: (2S)-2-[4-(1H-indol-3-yl)butanoylamino]propanoic acid. InChIKey: FSWQIRAILVPQQO-JTQLQIEISA-N.
| Molecular formula | C15H18N2O3 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | (2S)-2-[4-(1H-indol-3-yl)butanoylamino]propanoic acid |
| InChIKey | FSWQIRAILVPQQO-JTQLQIEISA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)CCCC1=CNC2=CC=CC=C21 |
Computed by PubChem (NCBI)