CAS 1185503-48-3 appears in our catalog under these names: Aprepitant Impurity C, Retigabine Dihydrochloride Impurity C, Fosaprepitant Impurity 31, Des-1,2,4-triazol-3-one-5-methyl (2S,3R,1'R)-Aprepitant, Aprepitant Impurity 23. Offered by: Chemat Brand, TRC, Hubei YoungXin. Available pack sizes: on request, 250mg, 10mg, 25mg, 50mg, 100mg, 200mg.
(2S,3R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine (CAS 1185503-48-3) is a chemical compound with the molecular formula C20H18F7NO2 and a molecular weight of 437.4 g/mol. IUPAC name: (2S,3R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine. InChIKey: AFBDSAJOMZYQAI-AFBMGJRZSA-N.
| Molecular formula | C20H18F7NO2 |
|---|---|
| Molecular weight | 437.4 g/mol |
| IUPAC name | (2S,3R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine |
| InChIKey | AFBDSAJOMZYQAI-AFBMGJRZSA-N |
| SMILES | C[C@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O[C@H]2[C@H](NCCO2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)