CAS 1242175-38-7 appears in our catalog under these names: Fosaprepitant Impurity 26, Aprepitant Impurity 25. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2S,3S)-2-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine (CAS 1242175-38-7) is a chemical compound with the molecular formula C20H18F7NO2 and a molecular weight of 437.4 g/mol. IUPAC name: (2S,3S)-2-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine. InChIKey: AFBDSAJOMZYQAI-NBHSMZAVSA-N.
| Molecular formula | C20H18F7NO2 |
|---|---|
| Molecular weight | 437.4 g/mol |
| IUPAC name | (2S,3S)-2-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine |
| InChIKey | AFBDSAJOMZYQAI-NBHSMZAVSA-N |
| SMILES | C[C@@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O[C@H]2[C@@H](NCCO2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)