CAS 380499-06-9 is the registry number for Aprepitant Impurity B;Retigabine Dihydrochloride Impurity B. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine (CAS 380499-06-9) is a chemical compound with the molecular formula C20H18F7NO2 and a molecular weight of 437.4 g/mol. IUPAC name: (2R,3R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine. InChIKey: AFBDSAJOMZYQAI-HWOJHCLVSA-N.
| Molecular formula | C20H18F7NO2 |
|---|---|
| Molecular weight | 437.4 g/mol |
| IUPAC name | (2R,3R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine |
| InChIKey | AFBDSAJOMZYQAI-HWOJHCLVSA-N |
| SMILES | C[C@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O[C@@H]2[C@H](NCCO2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)