CAS 1185516-79-3 is the registry number for Ramelteon Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]acetonitrile (CAS 1185516-79-3) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: 2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]acetonitrile. InChIKey: WPIVLYZNFICYFP-JTQLQIEISA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]acetonitrile |
| InChIKey | WPIVLYZNFICYFP-JTQLQIEISA-N |
| SMILES | C1CC2=C([C@@H]1CC#N)C3=C(C=C2)OCC3 |
Computed by PubChem (NCBI)