CAS 1217272-33-7 is the registry number for 2-(1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-yl)acetonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl)acetonitrile (CAS 1217272-33-7) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: 2-(2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl)acetonitrile. InChIKey: WPIVLYZNFICYFP-UHFFFAOYSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 2-(2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl)acetonitrile |
| InChIKey | WPIVLYZNFICYFP-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1CC#N)C3=C(C=C2)OCC3 |
Computed by PubChem (NCBI)