CAS 1185878-98-1 appears in our catalog under these names: Pentoxifylline-d6 (Dimethyl-d6), Pentoxifylline-d6, >95% (HPLC), Pentoxifylline-d6, 99.0%. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg, 5 mg, 10 mg.
1-(5-oxohexyl)-3,7-bis(trideuteriomethyl)purine-2,6-dione (CAS 1185878-98-1) is a chemical compound with the molecular formula C13H18N4O3 and a molecular weight of 284.34 g/mol. IUPAC name: 1-(5-oxohexyl)-3,7-bis(trideuteriomethyl)purine-2,6-dione. InChIKey: BYPFEZZEUUWMEJ-XERRXZQWSA-N.
| Molecular formula | C13H18N4O3 |
|---|---|
| Molecular weight | 284.34 g/mol |
| IUPAC name | 1-(5-oxohexyl)-3,7-bis(trideuteriomethyl)purine-2,6-dione |
| InChIKey | BYPFEZZEUUWMEJ-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])N1C=NC2=C1C(=O)N(C(=O)N2C([2H])([2H])[2H])CCCCC(=O)C |
Computed by PubChem (NCBI)