Products 708279-23-6
CAS 708279-23-6 appears in our catalog under these names: Nintedanib Impurity 79, 2-(4-Methylpiperazin-1-yl)-N-(4-nitrophenyl)acetamide, 98%, 4-Methyl-N-(4-nitrophenyl)-1-piperazineacetamide. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg.
2-(4-methylpiperazin-1-yl)-N-(4-nitrophenyl)acetamide (CAS 708279-23-6) is a chemical compound with the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. IUPAC name: 2-(4-methylpiperazin-1-yl)-N-(4-nitrophenyl)acetamide. InChIKey: ZHEAQYWUBKQPIO-UHFFFAOYSA-N.
| Molecular formula | C13H18N4O3 |
|---|---|
| Molecular weight | 278.31 g/mol |
| IUPAC name | 2-(4-methylpiperazin-1-yl)-N-(4-nitrophenyl)acetamide |
| InChIKey | ZHEAQYWUBKQPIO-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC(=O)NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)