Products 1185995-18-9
CAS 1185995-18-9 appears in our catalog under these names: Pentoxifylline-4',4',6',6',6'-d5, Pentoxifylline-4',4',6',6',6'-d5, 98 atom % D, min 98% Chemical Purity, Pentoxifylline–d5, Pentoxifylline-d5, 99.89%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, 0,05g, 0,01g, 10mg, 100mg, 25mg.
3,7-dimethyl-1-(4,4,6,6,6-pentadeuterio-5-oxohexyl)purine-2,6-dione (CAS 1185995-18-9) is a chemical compound with the molecular formula C13H18N4O3 and a molecular weight of 283.34 g/mol. IUPAC name: 3,7-dimethyl-1-(4,4,6,6,6-pentadeuterio-5-oxohexyl)purine-2,6-dione. InChIKey: BYPFEZZEUUWMEJ-YRYIGFSMSA-N.
| Molecular formula | C13H18N4O3 |
|---|---|
| Molecular weight | 283.34 g/mol |
| IUPAC name | 3,7-dimethyl-1-(4,4,6,6,6-pentadeuterio-5-oxohexyl)purine-2,6-dione |
| InChIKey | BYPFEZZEUUWMEJ-YRYIGFSMSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])CCCN1C(=O)C2=C(N=CN2C)N(C1=O)C |
Computed by PubChem (NCBI)