Products 118597-90-3

CAS 118597-90-3 is the registry number for Rel-dimethyl 2,2'-((3R,4S)-tetrahydrothiophene-3,4-diyl)diacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Methyl 2-[(3R,4S)-4-(2-methoxy-2-oxoethyl)thiolan-3-yl]acetate (CAS 118597-90-3) is a chemical compound with the molecular formula C10H16O4S and a molecular weight of 232.30 g/mol. IUPAC name: methyl 2-[(3R,4S)-4-(2-methoxy-2-oxoethyl)thiolan-3-yl]acetate. InChIKey: XHAWMWYMLINEFD-OCAPTIKFSA-N.

Identity
Molecular formulaC10H16O4S
Molecular weight232.30 g/mol
IUPAC namemethyl 2-[(3R,4S)-4-(2-methoxy-2-oxoethyl)thiolan-3-yl]acetate
InChIKeyXHAWMWYMLINEFD-OCAPTIKFSA-N
SMILESCOC(=O)C[C@H]1CSC[C@H]1CC(=O)OC

Computed by PubChem (NCBI)