Products 216884-00-3
CAS 216884-00-3 is the registry number for (2R,5S)-Diethyl tetrahydrothiophene-2,5-dicarboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Diethyl (2S,5R)-thiolane-2,5-dicarboxylate (CAS 216884-00-3) is a chemical compound with the molecular formula C10H16O4S and a molecular weight of 232.30 g/mol. IUPAC name: diethyl (2S,5R)-thiolane-2,5-dicarboxylate. InChIKey: CTAFSRRKAWJZRQ-OCAPTIKFSA-N.
| Molecular formula | C10H16O4S |
|---|---|
| Molecular weight | 232.30 g/mol |
| IUPAC name | diethyl (2S,5R)-thiolane-2,5-dicarboxylate |
| InChIKey | CTAFSRRKAWJZRQ-OCAPTIKFSA-N |
| SMILES | CCOC(=O)[C@H]1CC[C@H](S1)C(=O)OCC |
Computed by PubChem (NCBI)