Products 235753-82-9

CAS 235753-82-9 is the registry number for Methyl 4-((acetylthio)methyl)tetrahydro-2H-pyran-4-carboxylate 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-(acetylsulfanylmethyl)oxane-4-carboxylate (CAS 235753-82-9) is a chemical compound with the molecular formula C10H16O4S and a molecular weight of 232.30 g/mol. IUPAC name: methyl 4-(acetylsulfanylmethyl)oxane-4-carboxylate. InChIKey: SBKWLRQWJCVHOH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16O4S
Molecular weight232.30 g/mol
IUPAC namemethyl 4-(acetylsulfanylmethyl)oxane-4-carboxylate
InChIKeySBKWLRQWJCVHOH-UHFFFAOYSA-N
SMILESCC(=O)SCC1(CCOCC1)C(=O)OC

Computed by PubChem (NCBI)