CAS 1186194-42-2 is the registry number for tert-Butyl 3-(3-bromophenyl)-3,4-dihydroquinoxaline-1(2H)-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-(3-bromophenyl)-3,4-dihydro-2H-quinoxaline-1-carboxylate (CAS 1186194-42-2) is a chemical compound with the molecular formula C19H21BrN2O2 and a molecular weight of 389.3 g/mol. IUPAC name: tert-butyl 3-(3-bromophenyl)-3,4-dihydro-2H-quinoxaline-1-carboxylate. InChIKey: FAKYOWSEBJLQMA-UHFFFAOYSA-N.
| Molecular formula | C19H21BrN2O2 |
|---|---|
| Molecular weight | 389.3 g/mol |
| IUPAC name | tert-butyl 3-(3-bromophenyl)-3,4-dihydro-2H-quinoxaline-1-carboxylate |
| InChIKey | FAKYOWSEBJLQMA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(NC2=CC=CC=C21)C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)