CAS 1186194-93-3 is the registry number for 3-(4-Bromo-phenyl)-3,4-dihydro-2h-quinoxaline-1-carboxylic acid tert-butyl ester, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-(4-bromophenyl)-3,4-dihydro-2H-quinoxaline-1-carboxylate (CAS 1186194-93-3) is a chemical compound with the molecular formula C19H21BrN2O2 and a molecular weight of 389.3 g/mol. IUPAC name: tert-butyl 3-(4-bromophenyl)-3,4-dihydro-2H-quinoxaline-1-carboxylate. InChIKey: LRFFXEMAEKISOL-UHFFFAOYSA-N.
| Molecular formula | C19H21BrN2O2 |
|---|---|
| Molecular weight | 389.3 g/mol |
| IUPAC name | tert-butyl 3-(4-bromophenyl)-3,4-dihydro-2H-quinoxaline-1-carboxylate |
| InChIKey | LRFFXEMAEKISOL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(NC2=CC=CC=C21)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)