Products 2270907-79-2

CAS 2270907-79-2 is the registry number for [4-(4-Bromo-phenyl)-piperazin-1-yl]-acetic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Benzyl 2-[4-(4-bromophenyl)piperazin-1-yl]acetate (CAS 2270907-79-2) is a chemical compound with the molecular formula C19H21BrN2O2 and a molecular weight of 389.3 g/mol. IUPAC name: benzyl 2-[4-(4-bromophenyl)piperazin-1-yl]acetate. InChIKey: YTCCRTHNPGLFAC-UHFFFAOYSA-N.

Identity
Molecular formulaC19H21BrN2O2
Molecular weight389.3 g/mol
IUPAC namebenzyl 2-[4-(4-bromophenyl)piperazin-1-yl]acetate
InChIKeyYTCCRTHNPGLFAC-UHFFFAOYSA-N
SMILESC1CN(CCN1CC(=O)OCC2=CC=CC=C2)C3=CC=C(C=C3)Br

Computed by PubChem (NCBI)