CAS 1186234-47-8 is the registry number for 3-([1,1'-Biphenyl]-4-yloxy)azetidine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-phenylphenoxy)azetidine;hydrochloride (CAS 1186234-47-8) is a chemical compound with the molecular formula C15H16ClNO and a molecular weight of 261.74 g/mol. IUPAC name: 3-(4-phenylphenoxy)azetidine;hydrochloride. InChIKey: CVNOVPANGOZXQW-UHFFFAOYSA-N.
| Molecular formula | C15H16ClNO |
|---|---|
| Molecular weight | 261.74 g/mol |
| IUPAC name | 3-(4-phenylphenoxy)azetidine;hydrochloride |
| InChIKey | CVNOVPANGOZXQW-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC2=CC=C(C=C2)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)