CAS 610274-26-5 appears in our catalog under these names: 1-(1-Benzyl-2,5-dimethyl-1h-pyrrol-3-yl)-2-chloroethan-1-one, 95%, 1-(1-Benzyl-2,5-dimethyl-1h-pyrrol-3-yl)-2-chloroethan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 100mg, 1g.
1-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-chloroethanone (CAS 610274-26-5) is a chemical compound with the molecular formula C15H16ClNO and a molecular weight of 261.74 g/mol. IUPAC name: 1-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-chloroethanone. InChIKey: OXABFSIGNVGMCD-UHFFFAOYSA-N.
| Molecular formula | C15H16ClNO |
|---|---|
| Molecular weight | 261.74 g/mol |
| IUPAC name | 1-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-chloroethanone |
| InChIKey | OXABFSIGNVGMCD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1CC2=CC=CC=C2)C)C(=O)CCl |
Computed by PubChem (NCBI)