CAS 309721-18-4 is the registry number for 4-(4-Chloro-2,8-dimethylquinolin-3-yl)butan-2-one, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-(4-chloro-2,8-dimethylquinolin-3-yl)butan-2-one (CAS 309721-18-4) is a chemical compound with the molecular formula C15H16ClNO and a molecular weight of 261.74 g/mol. IUPAC name: 4-(4-chloro-2,8-dimethylquinolin-3-yl)butan-2-one. InChIKey: OHOJJBSFDXFRIJ-UHFFFAOYSA-N.
| Molecular formula | C15H16ClNO |
|---|---|
| Molecular weight | 261.74 g/mol |
| IUPAC name | 4-(4-chloro-2,8-dimethylquinolin-3-yl)butan-2-one |
| InChIKey | OHOJJBSFDXFRIJ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=C(C(=N2)C)CCC(=O)C)Cl |
Computed by PubChem (NCBI)