CAS 1186310-86-0 is the registry number for tert-Butyl (6-bromofuro[3,2-b]pyridin-2-yl)-methylcarbamate, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Tert-butyl N-[(6-bromofuro[3,2-b]pyridin-2-yl)methyl]carbamate (CAS 1186310-86-0) is a chemical compound with the molecular formula C13H15BrN2O3 and a molecular weight of 327.17 g/mol. IUPAC name: tert-butyl N-[(6-bromofuro[3,2-b]pyridin-2-yl)methyl]carbamate. InChIKey: YJVWCTUDWFQTDA-UHFFFAOYSA-N.
| Molecular formula | C13H15BrN2O3 |
|---|---|
| Molecular weight | 327.17 g/mol |
| IUPAC name | tert-butyl N-[(6-bromofuro[3,2-b]pyridin-2-yl)methyl]carbamate |
| InChIKey | YJVWCTUDWFQTDA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC2=C(O1)C=C(C=N2)Br |
Computed by PubChem (NCBI)