CAS 941294-22-0 appears in our catalog under these names: N-Cyclohexyl 3-bromo-5-nitrobenzamide, 98%, 3-Bromo-N-cyclohexyl-5-nitrobenzamide, 98%, 3-Bromo-N-cyclohexyl-5-nitrobenzamide. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g, 10g.
3-bromo-N-cyclohexyl-5-nitrobenzamide (CAS 941294-22-0) is a chemical compound with the molecular formula C13H15BrN2O3 and a molecular weight of 327.17 g/mol. IUPAC name: 3-bromo-N-cyclohexyl-5-nitrobenzamide. InChIKey: MHSNPMJGUJYBOT-UHFFFAOYSA-N.
| Molecular formula | C13H15BrN2O3 |
|---|---|
| Molecular weight | 327.17 g/mol |
| IUPAC name | 3-bromo-N-cyclohexyl-5-nitrobenzamide |
| InChIKey | MHSNPMJGUJYBOT-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)C2=CC(=CC(=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)