CAS 849537-85-5 is the registry number for N-Cyclohexyl 4-bromo-3-nitrobenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-bromo-N-cyclohexyl-3-nitrobenzamide (CAS 849537-85-5) is a chemical compound with the molecular formula C13H15BrN2O3 and a molecular weight of 327.17 g/mol. IUPAC name: 4-bromo-N-cyclohexyl-3-nitrobenzamide. InChIKey: PYLMKAHJFNUPPE-UHFFFAOYSA-N.
| Molecular formula | C13H15BrN2O3 |
|---|---|
| Molecular weight | 327.17 g/mol |
| IUPAC name | 4-bromo-N-cyclohexyl-3-nitrobenzamide |
| InChIKey | PYLMKAHJFNUPPE-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)C2=CC(=C(C=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)