Products 1550761-16-4
CAS 1550761-16-4 is the registry number for 4-Aminopyrazolo(1,5-a)-1,3,5-triazine-8-carboxylic Acid. Offered by: TRC. Available pack sizes: 250mg.
4-aminopyrazolo[1,5-a][1,3,5]triazine-8-carboxylic acid (CAS 1550761-16-4) is a chemical compound with the molecular formula C6H5N5O2 and a molecular weight of 179.14 g/mol. IUPAC name: 4-aminopyrazolo[1,5-a][1,3,5]triazine-8-carboxylic acid. InChIKey: KUHXPGKWJJVLAH-UHFFFAOYSA-N.
| Molecular formula | C6H5N5O2 |
|---|---|
| Molecular weight | 179.14 g/mol |
| IUPAC name | 4-aminopyrazolo[1,5-a][1,3,5]triazine-8-carboxylic acid |
| InChIKey | KUHXPGKWJJVLAH-UHFFFAOYSA-N |
| SMILES | C1=NN2C(=C1C(=O)O)N=CN=C2N |
Computed by PubChem (NCBI)