Products 1513232-64-8
CAS 1513232-64-8 is the registry number for 5-Amino-1H-pyrazolo[4,3-d]pyrimidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-amino-1H-pyrazolo[4,3-d]pyrimidine-3-carboxylic acid (CAS 1513232-64-8) is a chemical compound with the molecular formula C6H5N5O2 and a molecular weight of 179.14 g/mol. IUPAC name: 5-amino-1H-pyrazolo[4,3-d]pyrimidine-3-carboxylic acid. InChIKey: BIPRHXQBXFHGOU-UHFFFAOYSA-N.
| Molecular formula | C6H5N5O2 |
|---|---|
| Molecular weight | 179.14 g/mol |
| IUPAC name | 5-amino-1H-pyrazolo[4,3-d]pyrimidine-3-carboxylic acid |
| InChIKey | BIPRHXQBXFHGOU-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=N1)N)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)