Products 1186609-86-8
CAS 1186609-86-8 is the registry number for 3-Cyclobutyl-1h-pyrazolo[3,4-b]pyridin-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
3-cyclobutyl-2H-pyrazolo[3,4-b]pyridin-5-amine (CAS 1186609-86-8) is a chemical compound with the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. IUPAC name: 3-cyclobutyl-2H-pyrazolo[3,4-b]pyridin-5-amine. InChIKey: GARONWIYASFVRC-UHFFFAOYSA-N.
| Molecular formula | C10H12N4 |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 3-cyclobutyl-2H-pyrazolo[3,4-b]pyridin-5-amine |
| InChIKey | GARONWIYASFVRC-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C2=C3C=C(C=NC3=NN2)N |
Computed by PubChem (NCBI)