CAS 52943-88-1 is the registry number for 3-Methyl-1-phenyl-1h-pyrazole-4,5-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-methyl-1-phenylpyrazole-4,5-diamine (CAS 52943-88-1) is a chemical compound with the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. IUPAC name: 3-methyl-1-phenylpyrazole-4,5-diamine. InChIKey: JSVCLRZBHIRDNZ-UHFFFAOYSA-N.
| Molecular formula | C10H12N4 |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 3-methyl-1-phenylpyrazole-4,5-diamine |
| InChIKey | JSVCLRZBHIRDNZ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1N)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)