CAS 848068-69-9 appears in our catalog under these names: 1-[4-(1H-1,2,4-Triazol-1-yl)phenyl]ethanamine, 95%, (1-[4-(1H-1,2,4-Triazol-1-yl)phenyl]ethyl)amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g, 10g.
1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine (CAS 848068-69-9) is a chemical compound with the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. IUPAC name: 1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine. InChIKey: LWCNLFHKRQJWOW-UHFFFAOYSA-N.
| Molecular formula | C10H12N4 |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine |
| InChIKey | LWCNLFHKRQJWOW-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)N2C=NC=N2)N |
Computed by PubChem (NCBI)