CAS 1186637-27-3 is the registry number for tert-Butyl (4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 1186637-27-3) is a chemical compound with the molecular formula C17H25BClNO4 and a molecular weight of 353.6 g/mol. IUPAC name: tert-butyl N-[4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: QEIYXAMDPDUVOX-UHFFFAOYSA-N.
| Molecular formula | C17H25BClNO4 |
|---|---|
| Molecular weight | 353.6 g/mol |
| IUPAC name | tert-butyl N-[4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | QEIYXAMDPDUVOX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)Cl)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)