CAS 1384312-60-0 appears in our catalog under these names: 3-(N-Boc-Amino)-5-chlorophenylboronic acid pinacol ester, 96%, 3-(N-BOC-Amino)-5-chlorophenylboronic acid pinacol ester, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Tert-butyl N-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 1384312-60-0) is a chemical compound with the molecular formula C17H25BClNO4 and a molecular weight of 353.6 g/mol. IUPAC name: tert-butyl N-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: IJXATTIEEWHUBH-UHFFFAOYSA-N.
| Molecular formula | C17H25BClNO4 |
|---|---|
| Molecular weight | 353.6 g/mol |
| IUPAC name | tert-butyl N-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | IJXATTIEEWHUBH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Cl)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)