Products 1620228-06-9
CAS 1620228-06-9 appears in our catalog under these names: 2-Chloro-4-(BOC-amino)phenylboronic acid, pinacol ester, 96%, 2-Chloro-4-(Boc-amino)phenylboronic acid pinacol ester, 97%, 97%, tert-Butyl (3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)carbamate, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg, 25g.
Tert-butyl N-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 1620228-06-9) is a chemical compound with the molecular formula C17H25BClNO4 and a molecular weight of 353.6 g/mol. IUPAC name: tert-butyl N-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: TWCHDIUTZFVAHM-UHFFFAOYSA-N.
| Molecular formula | C17H25BClNO4 |
|---|---|
| Molecular weight | 353.6 g/mol |
| IUPAC name | tert-butyl N-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | TWCHDIUTZFVAHM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)NC(=O)OC(C)(C)C)Cl |
Computed by PubChem (NCBI)