CAS 118715-27-8 is the registry number for 5-((tert-Butyldiphenylsilyl)oxy)pentanoic acid, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 100mg, 1g, 5g, 10g.
5-[tert-butyl(diphenyl)silyl]oxypentanoic acid (CAS 118715-27-8) is a chemical compound with the molecular formula C21H28O3Si and a molecular weight of 356.5 g/mol. IUPAC name: 5-[tert-butyl(diphenyl)silyl]oxypentanoic acid. InChIKey: XRGGRUWGKRJRLX-UHFFFAOYSA-N.
| Molecular formula | C21H28O3Si |
|---|---|
| Molecular weight | 356.5 g/mol |
| IUPAC name | 5-[tert-butyl(diphenyl)silyl]oxypentanoic acid |
| InChIKey | XRGGRUWGKRJRLX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCCCCC(=O)O |
Computed by PubChem (NCBI)