CAS 1360106-23-5 appears in our catalog under these names: (3-{[(tert-butyldiphenylsilyl)oxy]methyl}oxetan-3-yl)methanol, 97%, 97%, (3-{[(tert-butyldiphenylsilyl)oxy]methyl}oxetan-3-yl)methanol, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
[3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxetan-3-yl]methanol (CAS 1360106-23-5) is a chemical compound with the molecular formula C21H28O3Si and a molecular weight of 356.5 g/mol. IUPAC name: [3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxetan-3-yl]methanol. InChIKey: NWPICNKQTYPJSA-UHFFFAOYSA-N.
| Molecular formula | C21H28O3Si |
|---|---|
| Molecular weight | 356.5 g/mol |
| IUPAC name | [3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxetan-3-yl]methanol |
| InChIKey | NWPICNKQTYPJSA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCC3(COC3)CO |
Computed by PubChem (NCBI)