Products 179690-96-1

CAS 179690-96-1 is the registry number for Methyl 4-((tert-butyldiphenylsilyl)oxy)butanoate. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.

Structural formula: {0} (CAS {1})

Methyl 4-[tert-butyl(diphenyl)silyl]oxybutanoate (CAS 179690-96-1) is a chemical compound with the molecular formula C21H28O3Si and a molecular weight of 356.5 g/mol. IUPAC name: methyl 4-[tert-butyl(diphenyl)silyl]oxybutanoate. InChIKey: OLRGNNWNILVFQO-UHFFFAOYSA-N.

Identity
Molecular formulaC21H28O3Si
Molecular weight356.5 g/mol
IUPAC namemethyl 4-[tert-butyl(diphenyl)silyl]oxybutanoate
InChIKeyOLRGNNWNILVFQO-UHFFFAOYSA-N
SMILESCC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCCCC(=O)OC

Computed by PubChem (NCBI)