CAS 179690-96-1 is the registry number for Methyl 4-((tert-butyldiphenylsilyl)oxy)butanoate. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
Methyl 4-[tert-butyl(diphenyl)silyl]oxybutanoate (CAS 179690-96-1) is a chemical compound with the molecular formula C21H28O3Si and a molecular weight of 356.5 g/mol. IUPAC name: methyl 4-[tert-butyl(diphenyl)silyl]oxybutanoate. InChIKey: OLRGNNWNILVFQO-UHFFFAOYSA-N.
| Molecular formula | C21H28O3Si |
|---|---|
| Molecular weight | 356.5 g/mol |
| IUPAC name | methyl 4-[tert-butyl(diphenyl)silyl]oxybutanoate |
| InChIKey | OLRGNNWNILVFQO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCCCC(=O)OC |
Computed by PubChem (NCBI)