Products 1187168-16-6
CAS 1187168-16-6 is the registry number for 2-Chloro-5-(5-Chloro-2-thienyl)pyridine, 97%. Offered by: Fluorochem. Available pack sizes: 1g.
2-chloro-5-(5-chlorothiophen-2-yl)pyridine (CAS 1187168-16-6) is a chemical compound with the molecular formula C9H5Cl2NS and a molecular weight of 230.11 g/mol. IUPAC name: 2-chloro-5-(5-chlorothiophen-2-yl)pyridine. InChIKey: ZIDLEGDUWNLHNW-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NS |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 2-chloro-5-(5-chlorothiophen-2-yl)pyridine |
| InChIKey | ZIDLEGDUWNLHNW-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C2=CC=C(S2)Cl)Cl |
Computed by PubChem (NCBI)