Products 42444-92-8
CAS 42444-92-8 is the registry number for 2-Chloro-4-(2-chlorophenyl)-1,3-thiazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-chloro-4-(2-chlorophenyl)-1,3-thiazole (CAS 42444-92-8) is a chemical compound with the molecular formula C9H5Cl2NS and a molecular weight of 230.11 g/mol. IUPAC name: 2-chloro-4-(2-chlorophenyl)-1,3-thiazole. InChIKey: HYDQSALAQIARMT-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NS |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 2-chloro-4-(2-chlorophenyl)-1,3-thiazole |
| InChIKey | HYDQSALAQIARMT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CSC(=N2)Cl)Cl |
Computed by PubChem (NCBI)