CAS 383145-54-8 is the registry number for 4-(2,4-Dichlorophenyl)-1,3-thiazole, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
4-(2,4-dichlorophenyl)-1,3-thiazole (CAS 383145-54-8) is a chemical compound with the molecular formula C9H5Cl2NS and a molecular weight of 230.11 g/mol. IUPAC name: 4-(2,4-dichlorophenyl)-1,3-thiazole. InChIKey: KSGIKFJCCZIESB-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NS |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 4-(2,4-dichlorophenyl)-1,3-thiazole |
| InChIKey | KSGIKFJCCZIESB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=CSC=N2 |
Computed by PubChem (NCBI)