CAS 118724-99-5 appears in our catalog under these names: 2-(2-Acetamido-2-methylpropanamido)-2-methylpropanoic acid, 95%, 2–(2–Acetamido–2–methylpropanamido)–2–methylpropanoic acid, 2-(2-acetamido-2-methylpropanamido)-2-methylpropanoic acid. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 0,5g, 50mg.
2-[(2-acetamido-2-methylpropanoyl)amino]-2-methylpropanoic acid (CAS 118724-99-5) is a chemical compound with the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. IUPAC name: 2-[(2-acetamido-2-methylpropanoyl)amino]-2-methylpropanoic acid. InChIKey: IGBQCFANGWYUSJ-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O4 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 2-[(2-acetamido-2-methylpropanoyl)amino]-2-methylpropanoic acid |
| InChIKey | IGBQCFANGWYUSJ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)O |
Computed by PubChem (NCBI)