CAS 1187386-20-4 is the registry number for Methyl 8-methyl-4-oxo-5-trifluoromethyl-1,4-dihydroquinoline-2-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Methyl 8-methyl-4-oxo-5-(trifluoromethyl)-1H-quinoline-2-carboxylate (CAS 1187386-20-4) is a chemical compound with the molecular formula C13H10F3NO3 and a molecular weight of 285.22 g/mol. IUPAC name: methyl 8-methyl-4-oxo-5-(trifluoromethyl)-1H-quinoline-2-carboxylate. InChIKey: LGZHBJCNZIYFCS-UHFFFAOYSA-N.
| Molecular formula | C13H10F3NO3 |
|---|---|
| Molecular weight | 285.22 g/mol |
| IUPAC name | methyl 8-methyl-4-oxo-5-(trifluoromethyl)-1H-quinoline-2-carboxylate |
| InChIKey | LGZHBJCNZIYFCS-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)C(F)(F)F)C(=O)C=C(N2)C(=O)OC |
Computed by PubChem (NCBI)