CAS 175276-89-8 is the registry number for Methyl 3-methyl-5-[4-(trifluoromethyl)phenyl]isoxazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Methyl 3-methyl-5-[4-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxylate (CAS 175276-89-8) is a chemical compound with the molecular formula C13H10F3NO3 and a molecular weight of 285.22 g/mol. IUPAC name: methyl 3-methyl-5-[4-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxylate. InChIKey: JFXVMJOLMJJRDX-UHFFFAOYSA-N.
| Molecular formula | C13H10F3NO3 |
|---|---|
| Molecular weight | 285.22 g/mol |
| IUPAC name | methyl 3-methyl-5-[4-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxylate |
| InChIKey | JFXVMJOLMJJRDX-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1C(=O)OC)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)