CAS 1402881-80-4 is the registry number for Methyl 5-methyl-3-(3-(trifluoromethyl)phenyl)isoxazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-methyl-3-[3-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxylate (CAS 1402881-80-4) is a chemical compound with the molecular formula C13H10F3NO3 and a molecular weight of 285.22 g/mol. IUPAC name: methyl 5-methyl-3-[3-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxylate. InChIKey: YMGCYGOUCCYOJZ-UHFFFAOYSA-N.
| Molecular formula | C13H10F3NO3 |
|---|---|
| Molecular weight | 285.22 g/mol |
| IUPAC name | methyl 5-methyl-3-[3-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxylate |
| InChIKey | YMGCYGOUCCYOJZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC(=CC=C2)C(F)(F)F)C(=O)OC |
Computed by PubChem (NCBI)