Products 1187396-03-7
CAS 1187396-03-7 is the registry number for 1-[2-(butylamino)-5-nitrophenyl]ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-[2-(butylamino)-5-nitrophenyl]ethanone (CAS 1187396-03-7) is a chemical compound with the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. IUPAC name: 1-[2-(butylamino)-5-nitrophenyl]ethanone. InChIKey: SFXLTRBWWSQEID-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O3 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 1-[2-(butylamino)-5-nitrophenyl]ethanone |
| InChIKey | SFXLTRBWWSQEID-UHFFFAOYSA-N |
| SMILES | CCCCNC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)C |
Computed by PubChem (NCBI)