CAS 118740-38-8 is the registry number for Chlorodimethyl(2–phenylpropan–2–yl)silane. Offered by: GLPBio. Available pack sizes: 5g.
Chloro-dimethyl-(2-phenylpropan-2-yl)silane (CAS 118740-38-8) is a chemical compound with the molecular formula C11H17ClSi and a molecular weight of 212.79 g/mol. IUPAC name: chloro-dimethyl-(2-phenylpropan-2-yl)silane. InChIKey: SUMFNCSNBLYOEK-UHFFFAOYSA-N.
| Molecular formula | C11H17ClSi |
|---|---|
| Molecular weight | 212.79 g/mol |
| IUPAC name | chloro-dimethyl-(2-phenylpropan-2-yl)silane |
| InChIKey | SUMFNCSNBLYOEK-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1)[Si](C)(C)Cl |
Computed by PubChem (NCBI)