Products 1857235-32-5
CAS 1857235-32-5 is the registry number for (4-Chloro-2,5-dimethylphenyl)trimethylsilane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4-chloro-2,5-dimethylphenyl)-trimethylsilane (CAS 1857235-32-5) is a chemical compound with the molecular formula C11H17ClSi and a molecular weight of 212.79 g/mol. IUPAC name: (4-chloro-2,5-dimethylphenyl)-trimethylsilane. InChIKey: RAIZFUGOZDXXFX-UHFFFAOYSA-N.
| Molecular formula | C11H17ClSi |
|---|---|
| Molecular weight | 212.79 g/mol |
| IUPAC name | (4-chloro-2,5-dimethylphenyl)-trimethylsilane |
| InChIKey | RAIZFUGOZDXXFX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)C)[Si](C)(C)C |
Computed by PubChem (NCBI)