CAS 17146-09-7 appears in our catalog under these names: Chlorodimethyl(3–phenylpropyl)silane, Chlorodimethyl(3-phenylpropyl)silane, >97.0%(GC). Offered by: GLPBio, TCI. Available pack sizes: 25g, 5g, 5ml, 25ml.
Chloro-dimethyl-(3-phenylpropyl)silane (CAS 17146-09-7) is a chemical compound with the molecular formula C11H17ClSi and a molecular weight of 212.79 g/mol. IUPAC name: chloro-dimethyl-(3-phenylpropyl)silane. InChIKey: ASSMBLOISZSMMP-UHFFFAOYSA-N.
| Molecular formula | C11H17ClSi |
|---|---|
| Molecular weight | 212.79 g/mol |
| IUPAC name | chloro-dimethyl-(3-phenylpropyl)silane |
| InChIKey | ASSMBLOISZSMMP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(CCCC1=CC=CC=C1)Cl |
Computed by PubChem (NCBI)